C15H15Cl2NO2 — CID 106786294
[4-[(3,5-dichlorophenoxy)methyl]-2-methoxyphenyl]methanamine (PubChem CID 106786294) has the molecular formula C15H15Cl2NO2 and a molecular weight of 312.20 g/mol. Its IUPAC name is [4-[(3,5-dichlorophenoxy)methyl]-2-methoxyphenyl]methanamine.
| Compound Name | [4-[(3,5-dichlorophenoxy)methyl]-2-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 106786294 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | [4-[(3,5-dichlorophenoxy)methyl]-2-methoxyphenyl]methanamine |
| SMILES | COc1cc(COc2cc(Cl)cc(Cl)c2)ccc1CN |
| InChI | InChI=1S/C15H15Cl2NO2/c1-19-15-4-10(2-3-11(15)8-18)9-20-14-6-12(16)5-13(17)7-14/h2-7H,8-9,18H2,1H3 |
| InChIKey | ZEDPHDIZUJIONS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |