C15H14Cl3NO2 — CID 65338310
[2-methoxy-5-[(2,4,5-trichlorophenoxy)methyl]phenyl]methanamine (PubChem CID 65338310) has the molecular formula C15H14Cl3NO2 and a molecular weight of 346.64 g/mol. Its IUPAC name is [2-methoxy-5-[(2,4,5-trichlorophenoxy)methyl]phenyl]methanamine.
| Compound Name | [2-methoxy-5-[(2,4,5-trichlorophenoxy)methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 65338310 |
| Molecular Formula | C15H14Cl3NO2 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | [2-methoxy-5-[(2,4,5-trichlorophenoxy)methyl]phenyl]methanamine |
| SMILES | COc1ccc(COc2cc(Cl)c(Cl)cc2Cl)cc1CN |
| InChI | InChI=1S/C15H14Cl3NO2/c1-20-14-3-2-9(4-10(14)7-19)8-21-15-6-12(17)11(16)5-13(15)18/h2-6H,7-8,19H2,1H3 |
| InChIKey | WXCCGDWUEKHGCA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|