C15H18F3NOS — CID 106786521
2-adamantyl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol (PubChem CID 106786521) has the molecular formula C15H18F3NOS and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-adamantyl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol.
| Compound Name | 2-adamantyl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 106786521 |
| Molecular Formula | C15H18F3NOS |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-adamantyl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol |
| SMILES | OC(c1cnc(C(F)(F)F)s1)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C15H18F3NOS/c16-15(17,18)14-19-6-11(21-14)13(20)12-9-2-7-1-8(4-9)5-10(12)3-7/h6-10,12-13,20H,1-5H2 |
| InChIKey | JCAPPWMOWWUAJX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |