C12H10F3N3S2 — CID 106787592
2-cyclopropyl-5-methyl-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione (PubChem CID 106787592) has the molecular formula C12H10F3N3S2 and a molecular weight of 317.36 g/mol. Its IUPAC name is 2-cyclopropyl-5-methyl-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione.
| Compound Name | 2-cyclopropyl-5-methyl-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106787592 |
| Molecular Formula | C12H10F3N3S2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2-cyclopropyl-5-methyl-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione |
| SMILES | Cc1c(-c2cnc(C(F)(F)F)s2)[nH]c(C2CC2)nc1=S |
| InChI | InChI=1S/C12H10F3N3S2/c1-5-8(7-4-16-11(20-7)12(13,14)15)17-9(6-2-3-6)18-10(5)19/h4,6H,2-3H2,1H3,(H,17,18,19) |
| InChIKey | KNOQHCDJHPKVEY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|