C10H8F3N3S2 — CID 106787639
2-ethyl-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione (PubChem CID 106787639) has the molecular formula C10H8F3N3S2 and a molecular weight of 291.32 g/mol. Its IUPAC name is 2-ethyl-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione.
| Compound Name | 2-ethyl-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106787639 |
| Molecular Formula | C10H8F3N3S2 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-ethyl-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione |
| SMILES | CCc1nc(=S)cc(-c2cnc(C(F)(F)F)s2)[nH]1 |
| InChI | InChI=1S/C10H8F3N3S2/c1-2-7-15-5(3-8(17)16-7)6-4-14-9(18-6)10(11,12)13/h3-4H,2H2,1H3,(H,15,16,17) |
| InChIKey | QWCKCFNZOGVVHP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|