C8H3F4N3S2 — CID 106787590
5-fluoro-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-2-thione (PubChem CID 106787590) has the molecular formula C8H3F4N3S2 and a molecular weight of 281.26 g/mol. Its IUPAC name is 5-fluoro-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-2-thione.
| Compound Name | 5-fluoro-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 106787590 |
| Molecular Formula | C8H3F4N3S2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 5-fluoro-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-2-thione |
| SMILES | Fc1cnc(=S)[nH]c1-c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H3F4N3S2/c9-3-1-14-7(16)15-5(3)4-2-13-6(17-4)8(10,11)12/h1-2H,(H,14,15,16) |
| InChIKey | QEIJJZRSARKKHV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|