C10H4F6N2S2 — CID 106787570
4-(trifluoromethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridine-2-thione (PubChem CID 106787570) has the molecular formula C10H4F6N2S2 and a molecular weight of 330.28 g/mol. Its IUPAC name is 4-(trifluoromethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridine-2-thione.
| Compound Name | 4-(trifluoromethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 106787570 |
| Molecular Formula | C10H4F6N2S2 |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 4-(trifluoromethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridine-2-thione |
| SMILES | FC(F)(F)c1cc(-c2cnc(C(F)(F)F)s2)[nH]c(=S)c1 |
| InChI | InChI=1S/C10H4F6N2S2/c11-9(12,13)4-1-5(18-7(19)2-4)6-3-17-8(20-6)10(14,15)16/h1-3H,(H,18,19) |
| InChIKey | BGISDMOZFJTAJX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|