C9H5F3N2OS — CID 106787609
6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-2-one (PubChem CID 106787609) has the molecular formula C9H5F3N2OS and a molecular weight of 246.21 g/mol. Its IUPAC name is 6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-2-one.
| Compound Name | 6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 106787609 |
| Molecular Formula | C9H5F3N2OS |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-2-one |
| SMILES | O=c1cccc(-c2cnc(C(F)(F)F)s2)[nH]1 |
| InChI | InChI=1S/C9H5F3N2OS/c10-9(11,12)8-13-4-6(16-8)5-2-1-3-7(15)14-5/h1-4H,(H,14,15) |
| InChIKey | BLMMJWKTUJIXJR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |