C8H4F3N3S2 — CID 106787599
6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrazine-2-thione (PubChem CID 106787599) has the molecular formula C8H4F3N3S2 and a molecular weight of 263.27 g/mol. Its IUPAC name is 6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrazine-2-thione.
| Compound Name | 6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrazine-2-thione |
|---|---|
| PubChem CID | 106787599 |
| Molecular Formula | C8H4F3N3S2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrazine-2-thione |
| SMILES | FC(F)(F)c1ncc(-c2cncc(=S)[nH]2)s1 |
| InChI | InChI=1S/C8H4F3N3S2/c9-8(10,11)7-13-2-5(16-7)4-1-12-3-6(15)14-4/h1-3H,(H,14,15) |
| InChIKey | WPWYMEKRTSHSNT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|