C11H10F3N3OS2 — CID 106787576
2-(ethoxymethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione (PubChem CID 106787576) has the molecular formula C11H10F3N3OS2 and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-(ethoxymethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione.
| Compound Name | 2-(ethoxymethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106787576 |
| Molecular Formula | C11H10F3N3OS2 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-(ethoxymethyl)-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione |
| SMILES | CCOCc1nc(=S)cc(-c2cnc(C(F)(F)F)s2)[nH]1 |
| InChI | InChI=1S/C11H10F3N3OS2/c1-2-18-5-8-16-6(3-9(19)17-8)7-4-15-10(20-7)11(12,13)14/h3-4H,2,5H2,1H3,(H,16,17,19) |
| InChIKey | OPDRYHBJJGKPCP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|