C9H6F3N3OS2 — CID 106787643
5-methoxy-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione (PubChem CID 106787643) has the molecular formula C9H6F3N3OS2 and a molecular weight of 293.30 g/mol. Its IUPAC name is 5-methoxy-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione.
| Compound Name | 5-methoxy-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106787643 |
| Molecular Formula | C9H6F3N3OS2 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 5-methoxy-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyrimidine-4-thione |
| SMILES | COc1c(-c2cnc(C(F)(F)F)s2)[nH]cnc1=S |
| InChI | InChI=1S/C9H6F3N3OS2/c1-16-6-5(14-3-15-7(6)17)4-2-13-8(18-4)9(10,11)12/h2-3H,1H3,(H,14,15,17) |
| InChIKey | WKBKTOLYCLYNAY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|