C17H17BrN2O — CID 106787761
4-[(2-bromo-4,6-dimethylanilino)methyl]-2-methoxybenzonitrile (PubChem CID 106787761) has the molecular formula C17H17BrN2O and a molecular weight of 345.24 g/mol. Its IUPAC name is 4-[(2-bromo-4,6-dimethylanilino)methyl]-2-methoxybenzonitrile.
| Compound Name | 4-[(2-bromo-4,6-dimethylanilino)methyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 106787761 |
| Molecular Formula | C17H17BrN2O |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 4-[(2-bromo-4,6-dimethylanilino)methyl]-2-methoxybenzonitrile |
| SMILES | COc1cc(CNc2c(C)cc(C)cc2Br)ccc1C#N |
| InChI | InChI=1S/C17H17BrN2O/c1-11-6-12(2)17(15(18)7-11)20-10-13-4-5-14(9-19)16(8-13)21-3/h4-8,20H,10H2,1-3H3 |
| InChIKey | ZLVGEWYDAFPDHQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |