C15H19N3O2 — CID 106787949
4-[[2-cyanoethyl(2-methoxyethyl)amino]methyl]-2-methoxybenzonitrile (PubChem CID 106787949) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[[2-cyanoethyl(2-methoxyethyl)amino]methyl]-2-methoxybenzonitrile.
| Compound Name | 4-[[2-cyanoethyl(2-methoxyethyl)amino]methyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 106787949 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[[2-cyanoethyl(2-methoxyethyl)amino]methyl]-2-methoxybenzonitrile |
| SMILES | COCCN(CCC#N)Cc1ccc(C#N)c(OC)c1 |
| InChI | InChI=1S/C15H19N3O2/c1-19-9-8-18(7-3-6-16)12-13-4-5-14(11-17)15(10-13)20-2/h4-5,10H,3,7-9,12H2,1-2H3 |
| InChIKey | HZKHRBJGJDXOFM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |