C12H15Cl2N3O — CID 71986659
3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile (PubChem CID 71986659) has the molecular formula C12H15Cl2N3O and a molecular weight of 288.18 g/mol. Its IUPAC name is 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile.
| Compound Name | 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 71986659 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)Cc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O/c1-18-6-5-17(4-2-3-15)9-10-7-11(13)16-12(14)8-10/h7-8H,2,4-6,9H2,1H3 |
| InChIKey | QKJSNMAXFBUBMH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|