About 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile
3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile (PubChem CID 71986659) has the molecular formula C12H15Cl2N3O
and a molecular weight of 288.18 g/mol. Its IUPAC name is 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile.
Molecular Properties
| Compound Name | 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile |
| PubChem CID | 71986659 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)Cc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O/c1-18-6-5-17(4-2-3-15)9-10-7-11(13)16-12(14)8-10/h7-8H,2,4-6,9H2,1H3 |
| InChIKey | QKJSNMAXFBUBMH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile?
The IUPAC name of 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile (CID 71986659) is 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile.
What is the SMILES notation for 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile?
The canonical SMILES for 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile is COCCN(CCC#N)Cc1cc(Cl)nc(Cl)c1.
What is the InChIKey of 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile?
The InChIKey is QKJSNMAXFBUBMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2N3O/c1-18-6-5-17(4-2-3-15)9-10-7-11(13)16-12(14)8-10/h7-8H,2,4-6,9H2,1H3.
What are the key properties of 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile?
3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile has a molecular weight of 288.18 g/mol, XLogP of 2.75, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichloro-4-pyridinyl)methyl-(2-methoxyethyl)amino]propanenitrile is sourced from PubChem (CID 71986659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).