C12H16N2 — CID 10679181
(1R,5S)-1-pyridin-3-yl-8-azabicyclo[3.2.1]octane (PubChem CID 10679181) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (1R,5S)-1-pyridin-3-yl-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-1-pyridin-3-yl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 10679181 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (1R,5S)-1-pyridin-3-yl-8-azabicyclo[3.2.1]octane |
| SMILES | c1cncc([C@@]23CCC[C@@H](CC2)N3)c1 |
| InChI | InChI=1S/C12H16N2/c1-4-11-5-7-12(6-1,14-11)10-3-2-8-13-9-10/h2-3,8-9,11,14H,1,4-7H2/t11-,12+/m0/s1 |
| InChIKey | UMAFAWZJISMFTK-NWDGAFQWSA-N |
| XLogP | 2.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |