C14H17N3 — CID 87288239
[(7S)-7-pyridin-3-yl-6-azoniatricyclo[5.2.1.01,5]decan-6-ylidene]azanide (PubChem CID 87288239) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is [(7S)-7-pyridin-3-yl-6-azoniatricyclo[5.2.1.01,5]decan-6-ylidene]azanide.
| Compound Name | [(7S)-7-pyridin-3-yl-6-azoniatricyclo[5.2.1.01,5]decan-6-ylidene]azanide |
|---|---|
| PubChem CID | 87288239 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | [(7S)-7-pyridin-3-yl-6-azoniatricyclo[5.2.1.01,5]decan-6-ylidene]azanide |
| SMILES | [N-]=[N+]1C2CCCC23CC[C@@]1(c1cccnc1)C3 |
| InChI | InChI=1S/C14H17N3/c15-17-12-4-1-5-13(12)6-7-14(17,10-13)11-3-2-8-16-9-11/h2-3,8-9,12H,1,4-7,10H2/t12?,13?,14-/m0/s1 |
| InChIKey | AJRGHQBKCCKTAQ-RUXDESIVSA-N |
| XLogP | 3.05 |
| TPSA | 38.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|