C17H25N3O — CID 106792877
2-methoxy-4-[[propyl(pyrrolidin-2-ylmethyl)amino]methyl]benzonitrile (PubChem CID 106792877) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-methoxy-4-[[propyl(pyrrolidin-2-ylmethyl)amino]methyl]benzonitrile.
| Compound Name | 2-methoxy-4-[[propyl(pyrrolidin-2-ylmethyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 106792877 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-methoxy-4-[[propyl(pyrrolidin-2-ylmethyl)amino]methyl]benzonitrile |
| SMILES | CCCN(Cc1ccc(C#N)c(OC)c1)CC1CCCN1 |
| InChI | InChI=1S/C17H25N3O/c1-3-9-20(13-16-5-4-8-19-16)12-14-6-7-15(11-18)17(10-14)21-2/h6-7,10,16,19H,3-5,8-9,12-13H2,1-2H3 |
| InChIKey | XTZKVQLBSAQFJU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |