C16H24N4 — CID 106616666
4-[[butyl(pyrrolidin-2-ylmethyl)amino]methyl]pyridine-2-carbonitrile (PubChem CID 106616666) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 4-[[butyl(pyrrolidin-2-ylmethyl)amino]methyl]pyridine-2-carbonitrile.
| Compound Name | 4-[[butyl(pyrrolidin-2-ylmethyl)amino]methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 106616666 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 4-[[butyl(pyrrolidin-2-ylmethyl)amino]methyl]pyridine-2-carbonitrile |
| SMILES | CCCCN(Cc1ccnc(C#N)c1)CC1CCCN1 |
| InChI | InChI=1S/C16H24N4/c1-2-3-9-20(13-15-5-4-7-18-15)12-14-6-8-19-16(10-14)11-17/h6,8,10,15,18H,2-5,7,9,12-13H2,1H3 |
| InChIKey | HPOOTOYOOPXEBD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |