C17H22N2O — CID 106793854
[(3,5-dimethylphenyl)-(2-methoxy-4-methylphenyl)methyl]hydrazine (PubChem CID 106793854) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is [(3,5-dimethylphenyl)-(2-methoxy-4-methylphenyl)methyl]hydrazine.
| Compound Name | [(3,5-dimethylphenyl)-(2-methoxy-4-methylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106793854 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | [(3,5-dimethylphenyl)-(2-methoxy-4-methylphenyl)methyl]hydrazine |
| SMILES | COc1cc(C)ccc1C(NN)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C17H22N2O/c1-11-5-6-15(16(10-11)20-4)17(19-18)14-8-12(2)7-13(3)9-14/h5-10,17,19H,18H2,1-4H3 |
| InChIKey | OQYGGBBKSXKJLH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|