C17H22N2O2 — CID 105192250
[(3,4-dimethoxyphenyl)-(3,5-dimethylphenyl)methyl]hydrazine (PubChem CID 105192250) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is [(3,4-dimethoxyphenyl)-(3,5-dimethylphenyl)methyl]hydrazine.
| Compound Name | [(3,4-dimethoxyphenyl)-(3,5-dimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105192250 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | [(3,4-dimethoxyphenyl)-(3,5-dimethylphenyl)methyl]hydrazine |
| SMILES | COc1ccc(C(NN)c2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C17H22N2O2/c1-11-7-12(2)9-14(8-11)17(19-18)13-5-6-15(20-3)16(10-13)21-4/h5-10,17,19H,18H2,1-4H3 |
| InChIKey | VCBARFUROXJQRC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|