C16H19BrN2O2 — CID 107986014
[(2-bromo-3-methylphenyl)-(3,4-dimethoxyphenyl)methyl]hydrazine (PubChem CID 107986014) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is [(2-bromo-3-methylphenyl)-(3,4-dimethoxyphenyl)methyl]hydrazine.
| Compound Name | [(2-bromo-3-methylphenyl)-(3,4-dimethoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107986014 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | [(2-bromo-3-methylphenyl)-(3,4-dimethoxyphenyl)methyl]hydrazine |
| SMILES | COc1ccc(C(NN)c2cccc(C)c2Br)cc1OC |
| InChI | InChI=1S/C16H19BrN2O2/c1-10-5-4-6-12(15(10)17)16(19-18)11-7-8-13(20-2)14(9-11)21-3/h4-9,16,19H,18H2,1-3H3 |
| InChIKey | RDIPYVCBBXWBSA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|