C12H15ClN2O — CID 106794814
4-but-3-yn-2-yloxy-6-chloro-5-methyl-2-propylpyrimidine (PubChem CID 106794814) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 4-but-3-yn-2-yloxy-6-chloro-5-methyl-2-propylpyrimidine.
| Compound Name | 4-but-3-yn-2-yloxy-6-chloro-5-methyl-2-propylpyrimidine |
|---|---|
| PubChem CID | 106794814 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-but-3-yn-2-yloxy-6-chloro-5-methyl-2-propylpyrimidine |
| SMILES | C#CC(C)Oc1nc(CCC)nc(Cl)c1C |
| InChI | InChI=1S/C12H15ClN2O/c1-5-7-10-14-11(13)9(4)12(15-10)16-8(3)6-2/h2,8H,5,7H2,1,3-4H3 |
| InChIKey | JZHYLTZVXQYGJW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|