C13H18ClN3 — CID 106196052
6-chloro-5-methyl-N-pent-4-yn-2-yl-2-propylpyrimidin-4-amine (PubChem CID 106196052) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-pent-4-yn-2-yl-2-propylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-N-pent-4-yn-2-yl-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106196052 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 6-chloro-5-methyl-N-pent-4-yn-2-yl-2-propylpyrimidin-4-amine |
| SMILES | C#CCC(C)Nc1nc(CCC)nc(Cl)c1C |
| InChI | InChI=1S/C13H18ClN3/c1-5-7-9(3)15-13-10(4)12(14)16-11(17-13)8-6-2/h1,9H,6-8H2,2-4H3,(H,15,16,17) |
| InChIKey | BCFFNPKYCMKDMI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|