C14H24ClN3O — CID 114156614
2-[(6-chloro-5-methyl-2-propylpyrimidin-4-yl)amino]-4-methylpentan-1-ol (PubChem CID 114156614) has the molecular formula C14H24ClN3O and a molecular weight of 285.82 g/mol. Its IUPAC name is 2-[(6-chloro-5-methyl-2-propylpyrimidin-4-yl)amino]-4-methylpentan-1-ol.
| Compound Name | 2-[(6-chloro-5-methyl-2-propylpyrimidin-4-yl)amino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 114156614 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-[(6-chloro-5-methyl-2-propylpyrimidin-4-yl)amino]-4-methylpentan-1-ol |
| SMILES | CCCc1nc(Cl)c(C)c(NC(CO)CC(C)C)n1 |
| InChI | InChI=1S/C14H24ClN3O/c1-5-6-12-17-13(15)10(4)14(18-12)16-11(8-19)7-9(2)3/h9,11,19H,5-8H2,1-4H3,(H,16,17,18) |
| InChIKey | XLOMYOGGHBQVLA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |