C13H25N5O2 — CID 114212333
2-[(6-hydrazinyl-5-methyl-2-propylpyrimidin-4-yl)amino]-4-methoxybutan-1-ol (PubChem CID 114212333) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-5-methyl-2-propylpyrimidin-4-yl)amino]-4-methoxybutan-1-ol.
| Compound Name | 2-[(6-hydrazinyl-5-methyl-2-propylpyrimidin-4-yl)amino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 114212333 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 2-[(6-hydrazinyl-5-methyl-2-propylpyrimidin-4-yl)amino]-4-methoxybutan-1-ol |
| SMILES | CCCc1nc(NN)c(C)c(NC(CO)CCOC)n1 |
| InChI | InChI=1S/C13H25N5O2/c1-4-5-11-16-12(9(2)13(17-11)18-14)15-10(8-19)6-7-20-3/h10,19H,4-8,14H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | AYWFCBVMSFYTDH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|