C13H16N6O — CID 106795382
4-but-3-yn-2-yloxy-6-imidazol-1-yl-N-propyl-1,3,5-triazin-2-amine (PubChem CID 106795382) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-but-3-yn-2-yloxy-6-imidazol-1-yl-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-but-3-yn-2-yloxy-6-imidazol-1-yl-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106795382 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-but-3-yn-2-yloxy-6-imidazol-1-yl-N-propyl-1,3,5-triazin-2-amine |
| SMILES | C#CC(C)Oc1nc(NCCC)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C13H16N6O/c1-4-6-15-11-16-12(19-8-7-14-9-19)18-13(17-11)20-10(3)5-2/h2,7-10H,4,6H2,1,3H3,(H,15,16,17,18) |
| InChIKey | HMVPGDPGCCVTJW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|