C9H12N4O — CID 106795434
6-but-3-yn-2-yloxy-4-N-methylpyrimidine-2,4-diamine (PubChem CID 106795434) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 6-but-3-yn-2-yloxy-4-N-methylpyrimidine-2,4-diamine.
| Compound Name | 6-but-3-yn-2-yloxy-4-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106795434 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 6-but-3-yn-2-yloxy-4-N-methylpyrimidine-2,4-diamine |
| SMILES | C#CC(C)Oc1cc(NC)nc(N)n1 |
| InChI | InChI=1S/C9H12N4O/c1-4-6(2)14-8-5-7(11-3)12-9(10)13-8/h1,5-6H,2-3H3,(H3,10,11,12,13) |
| InChIKey | GPRSCWXUVAUADM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|