C10H18N4O — CID 80858428
4-N-methyl-6-(3-methylbutoxy)pyrimidine-2,4-diamine (PubChem CID 80858428) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-N-methyl-6-(3-methylbutoxy)pyrimidine-2,4-diamine.
| Compound Name | 4-N-methyl-6-(3-methylbutoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80858428 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 4-N-methyl-6-(3-methylbutoxy)pyrimidine-2,4-diamine |
| SMILES | CNc1cc(OCCC(C)C)nc(N)n1 |
| InChI | InChI=1S/C10H18N4O/c1-7(2)4-5-15-9-6-8(12-3)13-10(11)14-9/h6-7H,4-5H2,1-3H3,(H3,11,12,13,14) |
| InChIKey | ZGKGSPDVROGMEK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |