C12H17N3O — CID 106795584
6-but-3-ynoxy-2-ethyl-N,5-dimethylpyrimidin-4-amine (PubChem CID 106795584) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 6-but-3-ynoxy-2-ethyl-N,5-dimethylpyrimidin-4-amine.
| Compound Name | 6-but-3-ynoxy-2-ethyl-N,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106795584 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 6-but-3-ynoxy-2-ethyl-N,5-dimethylpyrimidin-4-amine |
| SMILES | C#CCCOc1nc(CC)nc(NC)c1C |
| InChI | InChI=1S/C12H17N3O/c1-5-7-8-16-12-9(3)11(13-4)14-10(6-2)15-12/h1H,6-8H2,2-4H3,(H,13,14,15) |
| InChIKey | LMTQOJCLGJMXPZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|