C11H12BrF3N4O2 — CID 106795885
4-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-hydroxymorpholine-2-carboximidamide (PubChem CID 106795885) has the molecular formula C11H12BrF3N4O2 and a molecular weight of 369.14 g/mol. Its IUPAC name is 4-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-hydroxymorpholine-2-carboximidamide.
| Compound Name | 4-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-hydroxymorpholine-2-carboximidamide |
|---|---|
| PubChem CID | 106795885 |
| Molecular Formula | C11H12BrF3N4O2 |
| Molecular Weight | 369.14 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 4-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-hydroxymorpholine-2-carboximidamide |
| SMILES | NC(=NO)C1CN(c2ncc(Br)cc2C(F)(F)F)CCO1 |
| InChI | InChI=1S/C11H12BrF3N4O2/c12-6-3-7(11(13,14)15)10(17-4-6)19-1-2-21-8(5-19)9(16)18-20/h3-4,8,20H,1-2,5H2,(H2,16,18) |
| InChIKey | GERMLMYFTBSWIO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|