C13H17BrF3N3 — CID 106796608
1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-3-ethylpiperidin-4-amine (PubChem CID 106796608) has the molecular formula C13H17BrF3N3 and a molecular weight of 352.20 g/mol. Its IUPAC name is 1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-3-ethylpiperidin-4-amine.
| Compound Name | 1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-3-ethylpiperidin-4-amine |
|---|---|
| PubChem CID | 106796608 |
| Molecular Formula | C13H17BrF3N3 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-3-ethylpiperidin-4-amine |
| SMILES | CCC1CN(c2ncc(Br)cc2C(F)(F)F)CCC1N |
| InChI | InChI=1S/C13H17BrF3N3/c1-2-8-7-20(4-3-11(8)18)12-10(13(15,16)17)5-9(14)6-19-12/h5-6,8,11H,2-4,7,18H2,1H3 |
| InChIKey | BFWKFUAQDITRFL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |