C13H17BrF3N3 — CID 106796530
1-[1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-N-methylmethanamine (PubChem CID 106796530) has the molecular formula C13H17BrF3N3 and a molecular weight of 352.20 g/mol. Its IUPAC name is 1-[1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-N-methylmethanamine.
| Compound Name | 1-[1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 106796530 |
| Molecular Formula | C13H17BrF3N3 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 1-[1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-N-methylmethanamine |
| SMILES | CNCC1CCN(c2ncc(Br)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H17BrF3N3/c1-18-7-9-2-4-20(5-3-9)12-11(13(15,16)17)6-10(14)8-19-12/h6,8-9,18H,2-5,7H2,1H3 |
| InChIKey | JTBBKWVAUAYCJP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |