C14H18BrF3N2O — CID 106796244
1-[[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]amino]methyl]-4-methylcyclohexan-1-ol (PubChem CID 106796244) has the molecular formula C14H18BrF3N2O and a molecular weight of 367.21 g/mol. Its IUPAC name is 1-[[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]amino]methyl]-4-methylcyclohexan-1-ol.
| Compound Name | 1-[[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]amino]methyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 106796244 |
| Molecular Formula | C14H18BrF3N2O |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 1-[[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]amino]methyl]-4-methylcyclohexan-1-ol |
| SMILES | CC1CCC(O)(CNc2ncc(Br)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H18BrF3N2O/c1-9-2-4-13(21,5-3-9)8-20-12-11(14(16,17)18)6-10(15)7-19-12/h6-7,9,21H,2-5,8H2,1H3,(H,19,20) |
| InChIKey | XTVITUNTOPFYKZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |