C13H16O2 — CID 10679719
6,6-dimethyl-3a,5,7,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-one (PubChem CID 10679719) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 6,6-dimethyl-3a,5,7,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-one.
| Compound Name | 6,6-dimethyl-3a,5,7,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-one |
|---|---|
| PubChem CID | 10679719 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 6,6-dimethyl-3a,5,7,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1C=CCC21 |
| InChI | InChI=1S/C13H16O2/c1-13(2)6-9(14)12-8-4-3-5-10(8)15-11(12)7-13/h3,5,8,10H,4,6-7H2,1-2H3 |
| InChIKey | MFFTZSRRGVWFEI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|