C13H28N2 — CID 106799304
1-N-cyclopropyl-1-N,4-N-diethylhexane-1,4-diamine (PubChem CID 106799304) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-N-cyclopropyl-1-N,4-N-diethylhexane-1,4-diamine.
| Compound Name | 1-N-cyclopropyl-1-N,4-N-diethylhexane-1,4-diamine |
|---|---|
| PubChem CID | 106799304 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1-N-cyclopropyl-1-N,4-N-diethylhexane-1,4-diamine |
| SMILES | CCNC(CC)CCCN(CC)C1CC1 |
| InChI | InChI=1S/C13H28N2/c1-4-12(14-5-2)8-7-11-15(6-3)13-9-10-13/h12-14H,4-11H2,1-3H3 |
| InChIKey | DMUNESGFSMGBBH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |