C13H29N — CID 82925508
N,7-diethylnonan-3-amine (PubChem CID 82925508) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is N,7-diethylnonan-3-amine.
| Compound Name | N,7-diethylnonan-3-amine |
|---|---|
| PubChem CID | 82925508 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | N,7-diethylnonan-3-amine |
| SMILES | CCNC(CC)CCCC(CC)CC |
| InChI | InChI=1S/C13H29N/c1-5-12(6-2)10-9-11-13(7-3)14-8-4/h12-14H,5-11H2,1-4H3 |
| InChIKey | LJXRTCCBYFYSBM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |