C14H21NO — CID 106801284
6-(N,2-dimethylanilino)hexan-3-one (PubChem CID 106801284) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 6-(N,2-dimethylanilino)hexan-3-one.
| Compound Name | 6-(N,2-dimethylanilino)hexan-3-one |
|---|---|
| PubChem CID | 106801284 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 6-(N,2-dimethylanilino)hexan-3-one |
| SMILES | CCC(=O)CCCN(C)c1ccccc1C |
| InChI | InChI=1S/C14H21NO/c1-4-13(16)9-7-11-15(3)14-10-6-5-8-12(14)2/h5-6,8,10H,4,7,9,11H2,1-3H3 |
| InChIKey | HLIDZEWCPNFDGS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |