About 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole
1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole (PubChem CID 10680142) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole.
Molecular Properties
| Compound Name | 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole |
| PubChem CID | 10680142 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole |
| SMILES | C(\Cn1ccnc1)=C1/CCCc2occc21 |
| InChI | InChI=1S/C13H14N2O/c1-2-11(4-7-15-8-6-14-10-15)12-5-9-16-13(12)3-1/h4-6,8-10H,1-3,7H2/b11-4- |
| InChIKey | AHZCDINNUVENGR-WCIBSUBMSA-N |
| XLogP | 2.90 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole?
The IUPAC name of 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole (CID 10680142) is 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole.
What is the SMILES notation for 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole?
The canonical SMILES for 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole is C(\Cn1ccnc1)=C1/CCCc2occc21.
What is the InChIKey of 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole?
The InChIKey is AHZCDINNUVENGR-WCIBSUBMSA-N. The full InChI is InChI=1S/C13H14N2O/c1-2-11(4-7-15-8-6-14-10-15)12-5-9-16-13(12)3-1/h4-6,8-10H,1-3,7H2/b11-4-.
What are the key properties of 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole?
1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole has a molecular weight of 214.27 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)ethyl]imidazole is sourced from PubChem (CID 10680142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).