C14H13BrN2O3S — CID 1068025
ethyl (4S)-6-amino-4-(5-bromothiophen-2-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 1068025) has the molecular formula C14H13BrN2O3S and a molecular weight of 369.24 g/mol. Its IUPAC name is ethyl (4S)-6-amino-4-(5-bromothiophen-2-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4S)-6-amino-4-(5-bromothiophen-2-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 1068025 |
| Molecular Formula | C14H13BrN2O3S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | ethyl (4S)-6-amino-4-(5-bromothiophen-2-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)[C@@H]1c1ccc(Br)s1 |
| InChI | InChI=1S/C14H13BrN2O3S/c1-3-19-14(18)11-7(2)20-13(17)8(6-16)12(11)9-4-5-10(15)21-9/h4-5,12H,3,17H2,1-2H3/t12-/m1/s1 |
| InChIKey | OKYFGGIWVCKSBN-GFCCVEGCSA-N |
| XLogP | 3.16 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_F(3)', 'substructure': 'N/A'} |
|---|