C14H12BrClN2O3S — CID 3644617
ethyl 6-amino-4-(5-bromothiophen-2-yl)-2-(chloromethyl)-5-cyano-4H-pyran-3-carboxylate (PubChem CID 3644617) has the molecular formula C14H12BrClN2O3S and a molecular weight of 403.69 g/mol. Its IUPAC name is ethyl 6-amino-4-(5-bromothiophen-2-yl)-2-(chloromethyl)-5-cyano-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-4-(5-bromothiophen-2-yl)-2-(chloromethyl)-5-cyano-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 3644617 |
| Molecular Formula | C14H12BrClN2O3S |
| Molecular Weight | 403.69 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | ethyl 6-amino-4-(5-bromothiophen-2-yl)-2-(chloromethyl)-5-cyano-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CCl)OC(N)=C(C#N)C1c1ccc(Br)s1 |
| InChI | InChI=1S/C14H12BrClN2O3S/c1-2-20-14(19)12-8(5-16)21-13(18)7(6-17)11(12)9-3-4-10(15)22-9/h3-4,11H,2,5,18H2,1H3 |
| InChIKey | QQNGSHRTJNCOQL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_F(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|