C17H29N3O — CID 106803254
5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(cyclopropylamino)-2-ethylpentanenitrile (PubChem CID 106803254) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(cyclopropylamino)-2-ethylpentanenitrile.
| Compound Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(cyclopropylamino)-2-ethylpentanenitrile |
|---|---|
| PubChem CID | 106803254 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(cyclopropylamino)-2-ethylpentanenitrile |
| SMILES | CCC(C#N)(CCCN1CCOC2CCCC21)NC1CC1 |
| InChI | InChI=1S/C17H29N3O/c1-2-17(13-18,19-14-7-8-14)9-4-10-20-11-12-21-16-6-3-5-15(16)20/h14-16,19H,2-12H2,1H3 |
| InChIKey | JIWCANABDVFBFC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |