C16H32N4 — CID 106803619
2-ethyl-2-(ethylamino)-5-[methyl(2-pyrrolidin-1-ylethyl)amino]pentanenitrile (PubChem CID 106803619) has the molecular formula C16H32N4 and a molecular weight of 280.46 g/mol. Its IUPAC name is 2-ethyl-2-(ethylamino)-5-[methyl(2-pyrrolidin-1-ylethyl)amino]pentanenitrile.
| Compound Name | 2-ethyl-2-(ethylamino)-5-[methyl(2-pyrrolidin-1-ylethyl)amino]pentanenitrile |
|---|---|
| PubChem CID | 106803619 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 2-ethyl-2-(ethylamino)-5-[methyl(2-pyrrolidin-1-ylethyl)amino]pentanenitrile |
| SMILES | CCNC(C#N)(CC)CCCN(C)CCN1CCCC1 |
| InChI | InChI=1S/C16H32N4/c1-4-16(15-17,18-5-2)9-8-10-19(3)13-14-20-11-6-7-12-20/h18H,4-14H2,1-3H3 |
| InChIKey | GQCMKVVZXWOLSR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |