C15H31N3 — CID 106803716
2-ethyl-2-(ethylamino)-5-[methyl(2-methylbutan-2-yl)amino]pentanenitrile (PubChem CID 106803716) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-ethyl-2-(ethylamino)-5-[methyl(2-methylbutan-2-yl)amino]pentanenitrile.
| Compound Name | 2-ethyl-2-(ethylamino)-5-[methyl(2-methylbutan-2-yl)amino]pentanenitrile |
|---|---|
| PubChem CID | 106803716 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 2-ethyl-2-(ethylamino)-5-[methyl(2-methylbutan-2-yl)amino]pentanenitrile |
| SMILES | CCNC(C#N)(CC)CCCN(C)C(C)(C)CC |
| InChI | InChI=1S/C15H31N3/c1-7-14(4,5)18(6)12-10-11-15(8-2,13-16)17-9-3/h17H,7-12H2,1-6H3 |
| InChIKey | WKSZTCCFDHEORR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |