C17H33N3 — CID 106803666
5-[cyclopentylmethyl(methyl)amino]-2-ethyl-2-(propylamino)pentanenitrile (PubChem CID 106803666) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 5-[cyclopentylmethyl(methyl)amino]-2-ethyl-2-(propylamino)pentanenitrile.
| Compound Name | 5-[cyclopentylmethyl(methyl)amino]-2-ethyl-2-(propylamino)pentanenitrile |
|---|---|
| PubChem CID | 106803666 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 5-[cyclopentylmethyl(methyl)amino]-2-ethyl-2-(propylamino)pentanenitrile |
| SMILES | CCCNC(C#N)(CC)CCCN(C)CC1CCCC1 |
| InChI | InChI=1S/C17H33N3/c1-4-12-19-17(5-2,15-18)11-8-13-20(3)14-16-9-6-7-10-16/h16,19H,4-14H2,1-3H3 |
| InChIKey | RQSDQDSEKFTODT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |