C16H33N3 — CID 106803371
2-ethyl-5-[methyl(3-methylbutyl)amino]-2-(propylamino)pentanenitrile (PubChem CID 106803371) has the molecular formula C16H33N3 and a molecular weight of 267.46 g/mol. Its IUPAC name is 2-ethyl-5-[methyl(3-methylbutyl)amino]-2-(propylamino)pentanenitrile.
| Compound Name | 2-ethyl-5-[methyl(3-methylbutyl)amino]-2-(propylamino)pentanenitrile |
|---|---|
| PubChem CID | 106803371 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | 2-ethyl-5-[methyl(3-methylbutyl)amino]-2-(propylamino)pentanenitrile |
| SMILES | CCCNC(C#N)(CC)CCCN(C)CCC(C)C |
| InChI | InChI=1S/C16H33N3/c1-6-11-18-16(7-2,14-17)10-8-12-19(5)13-9-15(3)4/h15,18H,6-13H2,1-5H3 |
| InChIKey | AFZMNBUDYRJMFZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |