C16H24N2O — CID 106804519
5-(2,3-dimethylphenoxy)-2-ethyl-2-(methylamino)pentanenitrile (PubChem CID 106804519) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-(2,3-dimethylphenoxy)-2-ethyl-2-(methylamino)pentanenitrile.
| Compound Name | 5-(2,3-dimethylphenoxy)-2-ethyl-2-(methylamino)pentanenitrile |
|---|---|
| PubChem CID | 106804519 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-(2,3-dimethylphenoxy)-2-ethyl-2-(methylamino)pentanenitrile |
| SMILES | CCC(C#N)(CCCOc1cccc(C)c1C)NC |
| InChI | InChI=1S/C16H24N2O/c1-5-16(12-17,18-4)10-7-11-19-15-9-6-8-13(2)14(15)3/h6,8-9,18H,5,7,10-11H2,1-4H3 |
| InChIKey | PHXDCSGNTJWGJS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|