C18H28N2O — CID 106804621
2-ethyl-2-(ethylamino)-5-(2,3,6-trimethylphenoxy)pentanenitrile (PubChem CID 106804621) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-ethyl-2-(ethylamino)-5-(2,3,6-trimethylphenoxy)pentanenitrile.
| Compound Name | 2-ethyl-2-(ethylamino)-5-(2,3,6-trimethylphenoxy)pentanenitrile |
|---|---|
| PubChem CID | 106804621 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-ethyl-2-(ethylamino)-5-(2,3,6-trimethylphenoxy)pentanenitrile |
| SMILES | CCNC(C#N)(CC)CCCOc1c(C)ccc(C)c1C |
| InChI | InChI=1S/C18H28N2O/c1-6-18(13-19,20-7-2)11-8-12-21-17-15(4)10-9-14(3)16(17)5/h9-10,20H,6-8,11-12H2,1-5H3 |
| InChIKey | LEFHAGSMBWIEAE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|