C12H18F6N2O — CID 106804946
2-ethyl-2-(ethylamino)-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanenitrile (PubChem CID 106804946) has the molecular formula C12H18F6N2O and a molecular weight of 320.28 g/mol. Its IUPAC name is 2-ethyl-2-(ethylamino)-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanenitrile.
| Compound Name | 2-ethyl-2-(ethylamino)-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanenitrile |
|---|---|
| PubChem CID | 106804946 |
| Molecular Formula | C12H18F6N2O |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-ethyl-2-(ethylamino)-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanenitrile |
| SMILES | CCNC(C#N)(CC)CCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18F6N2O/c1-3-10(8-19,20-4-2)6-5-7-21-9(11(13,14)15)12(16,17)18/h9,20H,3-7H2,1-2H3 |
| InChIKey | ZZTHQZVQHPLDGQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|