C9H11F6NO — CID 102722169
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylbutanenitrile (PubChem CID 102722169) has the molecular formula C9H11F6NO and a molecular weight of 263.18 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 102722169 |
| Molecular Formula | C9H11F6NO |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H11F6NO/c1-7(2,5-16)3-4-17-6(8(10,11)12)9(13,14)15/h6H,3-4H2,1-2H3 |
| InChIKey | JXUDVAMRAPAVGU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |