C16H27N3O2 — CID 106806565
2-(cyclopropylamino)-2-ethyl-5-(2-propan-2-ylimidazol-1-yl)pentanoic acid (PubChem CID 106806565) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-ethyl-5-(2-propan-2-ylimidazol-1-yl)pentanoic acid.
| Compound Name | 2-(cyclopropylamino)-2-ethyl-5-(2-propan-2-ylimidazol-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 106806565 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-(cyclopropylamino)-2-ethyl-5-(2-propan-2-ylimidazol-1-yl)pentanoic acid |
| SMILES | CCC(CCCn1ccnc1C(C)C)(NC1CC1)C(=O)O |
| InChI | InChI=1S/C16H27N3O2/c1-4-16(15(20)21,18-13-6-7-13)8-5-10-19-11-9-17-14(19)12(2)3/h9,11-13,18H,4-8,10H2,1-3H3,(H,20,21) |
| InChIKey | QKWYGNLPOJWBJO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |